CAS 154445-78-0 appears in our catalog under these names: 2,2,4,6,7-Pentamethyldihydrobenzofuran-5-sulfonyl chloride, tech. grade, 96%, 2,2,4,6,7-Pentamethyl-2,3-dihydrobenzofuran-5-sulfonyl Chloride (>80%), Pbf-Cl, Pbf-Cl 88%, 2,2,4,6,7-PENTAMETHYLDIHYDROBENZOFURAN-&. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 2,5g, 250mg, 500mg, 10g, 50g.
2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-sulfonyl chloride (CAS 154445-78-0) is a chemical compound with the molecular formula C13H17ClO3S and a molecular weight of 288.79 g/mol. IUPAC name: 2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-sulfonyl chloride. InChIKey: HLJKUZUILACRPQ-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO3S |
|---|---|
| Molecular weight | 288.79 g/mol |
| IUPAC name | 2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-sulfonyl chloride |
| InChIKey | HLJKUZUILACRPQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)