cas: 950-99-2 — see every product listed under this CAS number, including other names
2,2,5,7,8-Pentamethyl-6-Chromanol 95% (CAS 950-99-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A370347-250mg |
| cas | 950-99-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 10g | 798.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A370347 |
2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-ol (CAS 950-99-2) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. IUPAC name: 2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-ol. InChIKey: SEBPXHSZHLFWRL-UHFFFAOYSA-N.
| Molecular formula | C14H20O2 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-ol |
| InChIKey | SEBPXHSZHLFWRL-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(CCC(O2)(C)C)C(=C1O)C)C |
Computed by PubChem (NCBI)