cas: 25981-82-2 — see every product listed under this CAS number, including other names
2,3,3,5-Tetramethylindolenine, >98.0%(GC) (CAS 25981-82-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T3458-5G |
| cas | 25981-82-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 216.69 Pln | |
| TCI | 25g | 801.84 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2,3,3,5-tetramethylindole (CAS 25981-82-2) is a chemical compound with the molecular formula C12H15N and a molecular weight of 173.25 g/mol. IUPAC name: 2,3,3,5-tetramethylindole. InChIKey: RQVAPBRSUHSDGP-UHFFFAOYSA-N.
| Molecular formula | C12H15N |
|---|---|
| Molecular weight | 173.25 g/mol |
| IUPAC name | 2,3,3,5-tetramethylindole |
| InChIKey | RQVAPBRSUHSDGP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C2(C)C)C |
Computed by PubChem (NCBI)