cas: 771-56-2 — see every product listed under this CAS number, including other names
2,3,4,5,6-Pentafluorotoluene (CAS 771-56-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006822-25G |
| cas | 771-56-2 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 1976.41 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 627.92 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
1,2,3,4,5-pentafluoro-6-methylbenzene (CAS 771-56-2) is a chemical compound with the molecular formula C7H3F5 and a molecular weight of 182.09 g/mol. IUPAC name: 1,2,3,4,5-pentafluoro-6-methylbenzene. InChIKey: SXPRVMIZFRCAGC-UHFFFAOYSA-N.
| Molecular formula | C7H3F5 |
|---|---|
| Molecular weight | 182.09 g/mol |
| IUPAC name | 1,2,3,4,5-pentafluoro-6-methylbenzene |
| InChIKey | SXPRVMIZFRCAGC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)