cas: 50-74-8 — see every product listed under this CAS number, including other names
2,3,4,5-Tetrachlorobenzoic acid, ≥97%, ≥97% (CAS 50-74-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FDC-1g |
| cas | 50-74-8 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 25g | 150.80 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2,3,4,5-tetrachlorobenzoic acid (CAS 50-74-8) is a chemical compound with the molecular formula C7H2Cl4O2 and a molecular weight of 259.9 g/mol. IUPAC name: 2,3,4,5-tetrachlorobenzoic acid. InChIKey: FUXMTEKFGUWSNC-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl4O2 |
|---|---|
| Molecular weight | 259.9 g/mol |
| IUPAC name | 2,3,4,5-tetrachlorobenzoic acid |
| InChIKey | FUXMTEKFGUWSNC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)