cas: 47339-09-3 — see every product listed under this CAS number, including other names
2,3,4,6-Tetra-O-acetyl-D-galactopyranose 95+% (CAS 47339-09-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A104958-100mg |
| cas | 47339-09-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1327.12 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A104958 |
[(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl acetate (CAS 47339-09-3) is a chemical compound with the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. IUPAC name: [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl acetate. InChIKey: IEOLRPPTIGNUNP-RRYROLNDSA-N.
| Molecular formula | C14H20O10 |
|---|---|
| Molecular weight | 348.30 g/mol |
| IUPAC name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl acetate |
| InChIKey | IEOLRPPTIGNUNP-RRYROLNDSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H](C(O1)O)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)