cas: 47339-09-3 — see every product listed under this CAS number, including other names
2,3,4,6-Tetra-O-acetyl-D-galactopyranose, 97%, 97% (CAS 47339-09-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DBO0-50mg |
| cas | 47339-09-3 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 323.60 Pln | |
| Chemat | 100mg | 534.80 Pln | |
| Chemat | 250mg | 626.00 Pln | |
| Chemat | 1g | 2200.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl acetate (CAS 47339-09-3) is a chemical compound with the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. IUPAC name: [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl acetate. InChIKey: IEOLRPPTIGNUNP-RRYROLNDSA-N.
| Molecular formula | C14H20O10 |
|---|---|
| Molecular weight | 348.30 g/mol |
| IUPAC name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxyoxan-2-yl]methyl acetate |
| InChIKey | IEOLRPPTIGNUNP-RRYROLNDSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H](C(O1)O)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)