cas: 22383-85-3 — see every product listed under this CAS number, including other names
2,3,4-Trimethoxy-6-methylbenzaldehyde, 98% (CAS 22383-85-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689746-250MG |
| cas | 22383-85-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 820.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,3,4-trimethoxy-6-methylbenzaldehyde (CAS 22383-85-3) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 2,3,4-trimethoxy-6-methylbenzaldehyde. InChIKey: OMDNFMOQYYDECR-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2,3,4-trimethoxy-6-methylbenzaldehyde |
| InChIKey | OMDNFMOQYYDECR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C=O)OC)OC)OC |
Computed by PubChem (NCBI)