Products 5409-31-4
CAS 5409-31-4 appears in our catalog under these names: 3,4-Diethoxybenzoic acid, 98%, 3,4–Diethoxybenzoic acid, 3,4-Diethoxybenzoic acid, 3,4-Diethoxybenzoic Acid, >98.0%(GC)(T), 3,4-Diethoxybenzoic acid, 99%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Thermo Scientific (Acros). Available pack sizes: 100g, 25g, 5g, 500g, 0,25kg, 0,1kg, 0,5kg, 1kg.
3,4-diethoxybenzoic acid (CAS 5409-31-4) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 3,4-diethoxybenzoic acid. InChIKey: VVKCVAPLTRZJHH-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 3,4-diethoxybenzoic acid |
| InChIKey | VVKCVAPLTRZJHH-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(=O)O)OCC |
Computed by PubChem (NCBI)