cas: 22480-91-7 — see every product listed under this CAS number, including other names
2,3,4-Trimethoxyphenylacetic acid (CAS 22480-91-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 200mg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch118OEY-10mg |
| cas | 22480-91-7 |
| size | 10mg |
| availability | 0.6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 698.00 Pln | |
| Chemat | 50mg | 1566.80 Pln | |
| Chemat | 200mg | 5286.80 Pln | |
| Fluorochem | 10mg | 1127.75 Pln | |
| Fluorochem | 50mg | 2569.95 Pln |
| delivery time | 3 weeks |
|---|
2-(2,3,4-trimethoxyphenyl)acetic acid (CAS 22480-91-7) is a chemical compound with the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. IUPAC name: 2-(2,3,4-trimethoxyphenyl)acetic acid. InChIKey: ZMWCKCLDAQWIDA-UHFFFAOYSA-N.
| Molecular formula | C11H14O5 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 2-(2,3,4-trimethoxyphenyl)acetic acid |
| InChIKey | ZMWCKCLDAQWIDA-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CC(=O)O)OC)OC |
Computed by PubChem (NCBI)