Products 1898237-53-0

CAS 1898237-53-0 is the registry number for 2,5-Dimethoxy-4-(methoxymethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,5-dimethoxy-4-(methoxymethyl)benzoic acid (CAS 1898237-53-0) is a chemical compound with the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. IUPAC name: 2,5-dimethoxy-4-(methoxymethyl)benzoic acid. InChIKey: OKBRHCDKOPNLEG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O5
Molecular weight226.23 g/mol
IUPAC name2,5-dimethoxy-4-(methoxymethyl)benzoic acid
InChIKeyOKBRHCDKOPNLEG-UHFFFAOYSA-N
SMILESCOCC1=CC(=C(C=C1OC)C(=O)O)OC

Computed by PubChem (NCBI)