Products 29723-28-2
CAS 29723-28-2 appears in our catalog under these names: Methyl 2,4,6-trimethoxybenzoate, 95%, Methyl 2,4,6-trimethoxybenzoate, 98+%, Methyl 2,4,6–trimethoxybenzoate, 2,4,6-Trimethoxybenzoic acid methyl ester, Methyl 2,4,6-trimethoxybenzoate. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 2g, 50g.
Methyl 2,4,6-trimethoxybenzoate (CAS 29723-28-2) is a chemical compound with the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. IUPAC name: methyl 2,4,6-trimethoxybenzoate. InChIKey: CEARZEQLIHOYSV-UHFFFAOYSA-N.
| Molecular formula | C11H14O5 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | methyl 2,4,6-trimethoxybenzoate |
| InChIKey | CEARZEQLIHOYSV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)OC)OC |
Computed by PubChem (NCBI)