cas: 652-18-6 — see every product listed under this CAS number, including other names
2,3,5,6-Tetrafluorobenzoic Acid, >98.0%(GC)(T) (CAS 652-18-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1881-1G |
| cas | 652-18-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 128.18 Pln | |
| TCI | 5g | 359.29 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2,3,5,6-tetrafluorobenzoic acid (CAS 652-18-6) is a chemical compound with the molecular formula C7H2F4O2 and a molecular weight of 194.08 g/mol. IUPAC name: 2,3,5,6-tetrafluorobenzoic acid. InChIKey: KVLBXIOFJUWSJQ-UHFFFAOYSA-N.
| Molecular formula | C7H2F4O2 |
|---|---|
| Molecular weight | 194.08 g/mol |
| IUPAC name | 2,3,5,6-tetrafluorobenzoic acid |
| InChIKey | KVLBXIOFJUWSJQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)C(=O)O)F)F |
Computed by PubChem (NCBI)