2,3,5,6-Tetrafluorobenzoic acid, 97%
cas: 652-18-6 — see every product listed under this CAS number, including other names
2,3,5,6-Tetrafluorobenzoic acid, 97% (CAS 652-18-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044202-1G |
| cas | 652-18-6 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 357.18 Pln | |
| Fluorochem | 500g | 1476.58 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2,3,5,6-tetrafluorobenzoic acid (CAS 652-18-6) is a chemical compound with the molecular formula C7H2F4O2 and a molecular weight of 194.08 g/mol. IUPAC name: 2,3,5,6-tetrafluorobenzoic acid. InChIKey: KVLBXIOFJUWSJQ-UHFFFAOYSA-N.
| Molecular formula | C7H2F4O2 |
|---|---|
| Molecular weight | 194.08 g/mol |
| IUPAC name | 2,3,5,6-tetrafluorobenzoic acid |
| InChIKey | KVLBXIOFJUWSJQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)C(=O)O)F)F |
Computed by PubChem (NCBI)