cas: 34283-94-8 — see every product listed under this CAS number, including other names
2,3,5-TRICHLORONITROBENZENE, 97% (CAS 34283-94-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F501589-250MG |
| cas | 34283-94-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 721.64 Pln | |
| Fluorochem | 25g | 3314.48 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,2,5-trichloro-3-nitrobenzene (CAS 34283-94-8) is a chemical compound with the molecular formula C6H2Cl3NO2 and a molecular weight of 226.4 g/mol. IUPAC name: 1,2,5-trichloro-3-nitrobenzene. InChIKey: ZYJBTGNUWOMRBG-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO2 |
|---|---|
| Molecular weight | 226.4 g/mol |
| IUPAC name | 1,2,5-trichloro-3-nitrobenzene |
| InChIKey | ZYJBTGNUWOMRBG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)Cl)Cl |
Computed by PubChem (NCBI)