CAS 20098-48-0 appears in our catalog under these names: 3,4,5-Trichloronitrobenzene, 98%, 3,4,5-Trichloronitrobenzene, >95% (HPLC), 3,4,5–Trichloronitrobenzene, 3,4,5-Trichloronitrobenzene, >98.0%(GC), 1,2,3-Trichloro-5-nitrobenzene, 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Fluorochem. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 10g.
1,2,3-trichloro-5-nitrobenzene (CAS 20098-48-0) is a chemical compound with the molecular formula C6H2Cl3NO2 and a molecular weight of 226.4 g/mol. IUPAC name: 1,2,3-trichloro-5-nitrobenzene. InChIKey: HHLCSFGOTLUREE-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO2 |
|---|---|
| Molecular weight | 226.4 g/mol |
| IUPAC name | 1,2,3-trichloro-5-nitrobenzene |
| InChIKey | HHLCSFGOTLUREE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)