CAS 34283-94-8 appears in our catalog under these names: 2,3,5-Trichloronitrobenzene, 95%, 2,3,5–Trichloronitrobenzene, 1,2,5-Trichloro-3-nitrobenzene 97%, 2,3,5-Trichloronitrobenzene, 97%, 97%, 2,3,5-TRICHLORONITROBENZENE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g.
1,2,5-trichloro-3-nitrobenzene (CAS 34283-94-8) is a chemical compound with the molecular formula C6H2Cl3NO2 and a molecular weight of 226.4 g/mol. IUPAC name: 1,2,5-trichloro-3-nitrobenzene. InChIKey: ZYJBTGNUWOMRBG-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3NO2 |
|---|---|
| Molecular weight | 226.4 g/mol |
| IUPAC name | 1,2,5-trichloro-3-nitrobenzene |
| InChIKey | ZYJBTGNUWOMRBG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])Cl)Cl)Cl |
Computed by PubChem (NCBI)