2,3,5-Trichlorophenylboronic acid, 98%
cas: 212779-19-6 — see every product listed under this CAS number, including other names
2,3,5-Trichlorophenylboronic acid, 98% (CAS 212779-19-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 100g, 250mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F223755-5G |
| cas | 212779-19-6 |
| size | 5g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 10g | 513.38 Pln | |
| Fluorochem | 25g | 1153.78 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 392.62 Pln | |
| Ambeed | 10g | 709.69 Pln | |
| Ambeed | 25g | 1644.19 Pln | |
| Ambeed | 100g | 5793.81 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 184.40 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2,3,5-trichlorophenyl)boronic acid (CAS 212779-19-6) is a chemical compound with the molecular formula C6H4BCl3O2 and a molecular weight of 225.3 g/mol. IUPAC name: (2,3,5-trichlorophenyl)boronic acid. InChIKey: OPBCCRZCYTUJMS-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl3O2 |
|---|---|
| Molecular weight | 225.3 g/mol |
| IUPAC name | (2,3,5-trichlorophenyl)boronic acid |
| InChIKey | OPBCCRZCYTUJMS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1Cl)Cl)Cl)(O)O |
Computed by PubChem (NCBI)