cas: 914636-99-0 — see every product listed under this CAS number, including other names
2,3,5-Trifluorobenzenesulphonyl chloride 98% (CAS 914636-99-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A391313-100mg |
| cas | 914636-99-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 481.62 Pln | |
| Ambeed | 1g | 1210.31 Pln | |
| Ambeed | 5g | 3134.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A391313 |
2,3,5-trifluorobenzenesulfonyl chloride (CAS 914636-99-0) is a chemical compound with the molecular formula C6H2ClF3O2S and a molecular weight of 230.59 g/mol. IUPAC name: 2,3,5-trifluorobenzenesulfonyl chloride. InChIKey: UOBDGEAGDFWWOQ-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3O2S |
|---|---|
| Molecular weight | 230.59 g/mol |
| IUPAC name | 2,3,5-trifluorobenzenesulfonyl chloride |
| InChIKey | UOBDGEAGDFWWOQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)