CAS 220239-64-5 appears in our catalog under these names: 2,4,6-Trifluorobenzenesulfonyl chloride, 98%, 2,4,6-Trifluorobenzenesulfonyl chloride, 97% , 2,4,6-Trifluorobenzene-1-sulfonyl chloride 98%, 2,4,6-TRIFLUOROBENZENESULFONYL CHLORIDE, 2,4,6-Trifluorobenzenesulfonyl chloride, 97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g.
2,4,6-trifluorobenzenesulfonyl chloride (CAS 220239-64-5) is a chemical compound with the molecular formula C6H2ClF3O2S and a molecular weight of 230.59 g/mol. IUPAC name: 2,4,6-trifluorobenzenesulfonyl chloride. InChIKey: XINCBNCLCIQIJM-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3O2S |
|---|---|
| Molecular weight | 230.59 g/mol |
| IUPAC name | 2,4,6-trifluorobenzenesulfonyl chloride |
| InChIKey | XINCBNCLCIQIJM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)S(=O)(=O)Cl)F)F |
Computed by PubChem (NCBI)