CAS 914636-99-0 appears in our catalog under these names: 2,3,5-Trifluorobenzenesulphonyl chloride, 95%, 2,3,5–Trifluorobenzenesulphonyl chloride, 2,3,5-Trifluorobenzenesulphonyl chloride 98%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
2,3,5-trifluorobenzenesulfonyl chloride (CAS 914636-99-0) is a chemical compound with the molecular formula C6H2ClF3O2S and a molecular weight of 230.59 g/mol. IUPAC name: 2,3,5-trifluorobenzenesulfonyl chloride. InChIKey: UOBDGEAGDFWWOQ-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3O2S |
|---|---|
| Molecular weight | 230.59 g/mol |
| IUPAC name | 2,3,5-trifluorobenzenesulfonyl chloride |
| InChIKey | UOBDGEAGDFWWOQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)