cas: 603-81-6 — see every product listed under this CAS number, including other names
2,3-Diaminobenzoic acid, 98%, 98% (CAS 603-81-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 15g, 50g, 75g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E9X7-1g |
| cas | 603-81-6 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 25g | 520.40 Pln | |
| Chemat | 100g | 1629.20 Pln | |
| Chemat | 15g | 371.60 Pln | |
| Chemat | 50g | 938.00 Pln | |
| Chemat | 75g | 1360.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3-diaminobenzoic acid (CAS 603-81-6) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 2,3-diaminobenzoic acid. InChIKey: KKTUQAYCCLMNOA-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | 2,3-diaminobenzoic acid |
| InChIKey | KKTUQAYCCLMNOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)N)C(=O)O |
Computed by PubChem (NCBI)