Products 603-81-6
CAS 603-81-6 appears in our catalog under these names: 2,3-Diaminobenzoic acid, 98%, 2,3–Diaminobenzoic acid, 2,3-Diaminobenzoic acid, 2,3-Diaminobenzoic acid, 95%, 2,3-Diaminobenzoic acid 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Thermo Scientific (Acros), Ambeed. Available pack sizes: 25g, 5g, 100g, 1g, 10g, 50g, 15g, 75g.
2,3-diaminobenzoic acid (CAS 603-81-6) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 2,3-diaminobenzoic acid. InChIKey: KKTUQAYCCLMNOA-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | 2,3-diaminobenzoic acid |
| InChIKey | KKTUQAYCCLMNOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)N)C(=O)O |
Computed by PubChem (NCBI)