CAS 159275-52-2 is the registry number for 1,4-Dichloro-6-nitrophthalazine, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
1,4-dichloro-6-nitrophthalazine (CAS 159275-52-2) is a chemical compound with the molecular formula C8H3Cl2N3O2 and a molecular weight of 244.03 g/mol. IUPAC name: 1,4-dichloro-6-nitrophthalazine. InChIKey: NVBIMKGUWIFRHF-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2N3O2 |
|---|---|
| Molecular weight | 244.03 g/mol |
| IUPAC name | 1,4-dichloro-6-nitrophthalazine |
| InChIKey | NVBIMKGUWIFRHF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)