CAS 41195-90-8 appears in our catalog under these names: 2,3-Dichlorophenyl isocyanate, 2,3-Dichlorophenyl Isocyanate, >97.0%(GC), Benzene, 1,2-dichloro-3-isocyanato-, 95%, 95%. Offered by: Biosynth, TCI, Chemat. Available pack sizes: 50g, 25g, 1g, 5g.
1,2-dichloro-3-isocyanatobenzene (CAS 41195-90-8) is a chemical compound with the molecular formula C7H3Cl2NO and a molecular weight of 188.01 g/mol. IUPAC name: 1,2-dichloro-3-isocyanatobenzene. InChIKey: FYWJWWMKCARWQG-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 1,2-dichloro-3-isocyanatobenzene |
| InChIKey | FYWJWWMKCARWQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)N=C=O |
Computed by PubChem (NCBI)