CAS 3621-82-7 appears in our catalog under these names: 2,6-Dichlorobenzoxazole, 98%, 98%, 2,6-Dichlorobenzoxazole, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 500g, 1kg.
2,6-dichloro-1,3-benzoxazole (CAS 3621-82-7) is a chemical compound with the molecular formula C7H3Cl2NO and a molecular weight of 188.01 g/mol. IUPAC name: 2,6-dichloro-1,3-benzoxazole. InChIKey: LVVQTPZQNHQLOM-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 2,6-dichloro-1,3-benzoxazole |
| InChIKey | LVVQTPZQNHQLOM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)OC(=N2)Cl |
Computed by PubChem (NCBI)