Products 2904-62-3

CAS 2904-62-3 is the registry number for (2,6-dichlorophenyl)formonitrile oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,6-dichlorobenzonitrile oxide (CAS 2904-62-3) is a chemical compound with the molecular formula C7H3Cl2NO and a molecular weight of 188.01 g/mol. IUPAC name: 2,6-dichlorobenzonitrile oxide. InChIKey: XACGZMBUDCYGPB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2NO
Molecular weight188.01 g/mol
IUPAC name2,6-dichlorobenzonitrile oxide
InChIKeyXACGZMBUDCYGPB-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)C#[N+][O-])Cl

Computed by PubChem (NCBI)