CAS 2904-62-3 is the registry number for (2,6-dichlorophenyl)formonitrile oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2,6-dichlorobenzonitrile oxide (CAS 2904-62-3) is a chemical compound with the molecular formula C7H3Cl2NO and a molecular weight of 188.01 g/mol. IUPAC name: 2,6-dichlorobenzonitrile oxide. InChIKey: XACGZMBUDCYGPB-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 2,6-dichlorobenzonitrile oxide |
| InChIKey | XACGZMBUDCYGPB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C#[N+][O-])Cl |
Computed by PubChem (NCBI)