cas: 18355-73-2 — see every product listed under this CAS number, including other names
2,3-Difluorobenzoyl chloride, 97% (CAS 18355-73-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 1g, 10g. Offered by: Combi-blocks, Sigma-Aldrich, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QA-4586-25g |
| cas | 18355-73-2 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Sigma-Aldrich | 5G | 305.00 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 10g | 685.19 Pln | |
| Fluorochem | 25g | 1122.54 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,3-difluorobenzoyl chloride (CAS 18355-73-2) is a chemical compound with the molecular formula C7H3ClF2O and a molecular weight of 176.55 g/mol. IUPAC name: 2,3-difluorobenzoyl chloride. InChIKey: CDCFERWURRNLLA-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O |
|---|---|
| Molecular weight | 176.55 g/mol |
| IUPAC name | 2,3-difluorobenzoyl chloride |
| InChIKey | CDCFERWURRNLLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(=O)Cl |
Computed by PubChem (NCBI)