cas: 18355-73-2 — see every product listed under this CAS number, including other names
2,3-Difluorobenzoyl chloride, 98% (CAS 18355-73-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 375820010 |
| cas | 18355-73-2 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 114.92 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
2,3-difluorobenzoyl chloride (CAS 18355-73-2) is a chemical compound with the molecular formula C7H3ClF2O and a molecular weight of 176.55 g/mol. IUPAC name: 2,3-difluorobenzoyl chloride. InChIKey: CDCFERWURRNLLA-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O |
|---|---|
| Molecular weight | 176.55 g/mol |
| IUPAC name | 2,3-difluorobenzoyl chloride |
| InChIKey | CDCFERWURRNLLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(=O)Cl |
Computed by PubChem (NCBI)