cas: 765948-78-5 — see every product listed under this CAS number, including other names
2,3-Dihydro-1H-isoindol-1-one-4-boronic acid pinacol ester, 97% (CAS 765948-78-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225346-250MG |
| cas | 765948-78-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 388.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoindol-1-one (CAS 765948-78-5) is a chemical compound with the molecular formula C14H18BNO3 and a molecular weight of 259.11 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoindol-1-one. InChIKey: CXNFLUANJNYFBF-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO3 |
|---|---|
| Molecular weight | 259.11 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoindol-1-one |
| InChIKey | CXNFLUANJNYFBF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3CNC(=O)C3=CC=C2 |
Computed by PubChem (NCBI)