CAS 755030-94-5 is the registry number for 2-methoxy-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 755030-94-5) is a chemical compound with the molecular formula C14H18BNO3 and a molecular weight of 259.11 g/mol. IUPAC name: 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: GRFPVCGUHRGKBA-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO3 |
|---|---|
| Molecular weight | 259.11 g/mol |
| IUPAC name | 2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | GRFPVCGUHRGKBA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C#N)OC |
Computed by PubChem (NCBI)