CAS 936250-19-0 appears in our catalog under these names: 2-Cyanomethoxyphenylboronic acid, pinacol ester, 97%, 2-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetonitrile, 97%, 2-Cyanomethoxy-phenylboronic acid, pinacol ester/ 95+%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg.
2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetonitrile (CAS 936250-19-0) is a chemical compound with the molecular formula C14H18BNO3 and a molecular weight of 259.11 g/mol. IUPAC name: 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetonitrile. InChIKey: BQEHBQMAEHTZDU-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO3 |
|---|---|
| Molecular weight | 259.11 g/mol |
| IUPAC name | 2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetonitrile |
| InChIKey | BQEHBQMAEHTZDU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2OCC#N |
Computed by PubChem (NCBI)