cas: 98953-13-0 — see every product listed under this CAS number, including other names
2,3-Dihydro-benzo[1,4]dioxine-6-carboxylic acid hydrazide, 97% (CAS 98953-13-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F026686-100MG |
| cas | 98953-13-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 627.92 Pln | |
| Fluorochem | 250mg | 940.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,3-dihydro-1,4-benzodioxine-6-carbohydrazide (CAS 98953-13-0) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-6-carbohydrazide. InChIKey: YENPHHQNXHYBCE-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-6-carbohydrazide |
| InChIKey | YENPHHQNXHYBCE-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)NN |
Computed by PubChem (NCBI)