CAS 941291-25-4 is the registry number for 2-Methyl-7-nitro-3,4-dihydro-2H-1,4-benzoxazine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
2-methyl-7-nitro-3,4-dihydro-2H-1,4-benzoxazine (CAS 941291-25-4) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 2-methyl-7-nitro-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: XGQMNDZPLBYYTB-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 2-methyl-7-nitro-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | XGQMNDZPLBYYTB-UHFFFAOYSA-N |
| SMILES | CC1CNC2=C(O1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)