CAS 174567-34-1 appears in our catalog under these names: 2-Methyl-6-nitro-3,4-dihydro-2H-1,4-benzoxazine, 97%, 2H-1,4-Benzoxazine, 3,4-dihydro-3-methyl-6-nitro-, 97%, 2-METHYL-6-NITRO-3,4-DIHYDRO-2H-1,4-BENZOXAZINE. Offered by: Combi-blocks, Chemat Brand, Fluorochem. Available pack sizes: 1g, 10g, 5g, on request, 100mg, 250mg.
2-methyl-6-nitro-3,4-dihydro-2H-1,4-benzoxazine (CAS 174567-34-1) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 2-methyl-6-nitro-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: WTAGNTAYRIAHAZ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 2-methyl-6-nitro-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | WTAGNTAYRIAHAZ-UHFFFAOYSA-N |
| SMILES | CC1CNC2=C(O1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)