cas: 69999-16-2 — see every product listed under this CAS number, including other names
2,3-Dihydrobenzofuranyl-5-acetic acid 97% (CAS 69999-16-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A714320-1g |
| cas | 69999-16-2 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 10g | 209.06 Pln | |
| Ambeed | 25g | 264.69 Pln | |
| Ambeed | 100g | 820.94 Pln | |
| Ambeed | 500g | 3068.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A714320 |
2-(2,3-dihydro-1-benzofuran-5-yl)acetic acid (CAS 69999-16-2) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 2-(2,3-dihydro-1-benzofuran-5-yl)acetic acid. InChIKey: LALSYIKKTXUSLG-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 2-(2,3-dihydro-1-benzofuran-5-yl)acetic acid |
| InChIKey | LALSYIKKTXUSLG-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)