CAS 18310-60-6 appears in our catalog under these names: 3A-Methyl-3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1,3-dione(relative), 95%, rac-(1R,2S,6R,7S)-2-Methyl-4-oxatricyclo(5.2.1.0,2,6)dec-8-ene-3,5-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 50mg, 0,5g.
(1R,2S,6R,7S)-2-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 18310-60-6) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: (1R,2S,6R,7S)-2-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: LTVUCOSIZFEASK-NUMRIWBASA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (1R,2S,6R,7S)-2-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | LTVUCOSIZFEASK-NUMRIWBASA-N |
| SMILES | C[C@]12[C@@H]3C[C@H]([C@H]1C(=O)OC2=O)C=C3 |
Computed by PubChem (NCBI)