Products 62577-90-6
CAS 62577-90-6 appears in our catalog under these names: 4-Cyclopropoxybenzoic acid, 90%, 4-Cyclopropyloxybenzoic Acid, 4-Cyclopropoxybenzoic acid, 4-Cyclopropoxybenzoic acid 95%, 4-Cyclopropoxy-benzoic acid, 95%, 95%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
4-cyclopropyloxybenzoic acid (CAS 62577-90-6) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 4-cyclopropyloxybenzoic acid. InChIKey: VUANULXCHKBPDD-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 4-cyclopropyloxybenzoic acid |
| InChIKey | VUANULXCHKBPDD-UHFFFAOYSA-N |
| SMILES | C1CC1OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)