cas: 17635-26-6 — see every product listed under this CAS number, including other names
2,3-Dimethylquinoxaline-6-carboxylic acid, 97%, 97% (CAS 17635-26-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1135LQ-100mg |
| cas | 17635-26-6 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 25g | 1082.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,3-dimethylquinoxaline-6-carboxylic acid (CAS 17635-26-6) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 2,3-dimethylquinoxaline-6-carboxylic acid. InChIKey: RCACNAWRFYUKLC-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 2,3-dimethylquinoxaline-6-carboxylic acid |
| InChIKey | RCACNAWRFYUKLC-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C=C(C=CC2=N1)C(=O)O)C |
Computed by PubChem (NCBI)