cas: 50-82-8 — see every product listed under this CAS number, including other names
2,4,5-Trichlorobenzoic acid 95% (CAS 50-82-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A108403-250mg |
| cas | 50-82-8 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 392.62 Pln | |
| Ambeed | 100g | 1254.81 Pln | |
| Ambeed | 500g | 4597.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A108403 |
2,4,5-trichlorobenzoic acid (CAS 50-82-8) is a chemical compound with the molecular formula C7H3Cl3O2 and a molecular weight of 225.5 g/mol. IUPAC name: 2,4,5-trichlorobenzoic acid. InChIKey: PTFNNDHASFGWFI-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O2 |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 2,4,5-trichlorobenzoic acid |
| InChIKey | PTFNNDHASFGWFI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)