CAS 50-43-1 appears in our catalog under these names: 2,4,6-Trichlorobenzoic acid, 2,4,6–Trichlorobenzoic acid, 2,4,6-Trichlorobenzoic acid, 94% , 2,4,6-Trichlorobenzoic Acid, >98.0%(GC)(T), 2,4,6-Trichlorobenzoic acid 97%. Offered by: Chemat Brand, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: on request, 100g, 25g, 500g, 5g, 250g, 10g, 1000g.
2,4,6-trichlorobenzoic acid (CAS 50-43-1) is a chemical compound with the molecular formula C7H3Cl3O2 and a molecular weight of 225.5 g/mol. IUPAC name: 2,4,6-trichlorobenzoic acid. InChIKey: RAFFVQBMVYYTQS-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O2 |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 2,4,6-trichlorobenzoic acid |
| InChIKey | RAFFVQBMVYYTQS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)