Products 50-75-9
CAS 50-75-9 appears in our catalog under these names: 2,3,4-trichlorobenzoic acid, 2,3,4-Trichlorobenzoic acid 98%, 2,3,4-trichlorobenzoic acid, 98%, 98%, 2,3,4-Trichlorobenzoic acid, 98%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 500mg.
2,3,4-trichlorobenzoic acid (CAS 50-75-9) is a chemical compound with the molecular formula C7H3Cl3O2 and a molecular weight of 225.5 g/mol. IUPAC name: 2,3,4-trichlorobenzoic acid. InChIKey: ALLSOOQIDPLIER-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O2 |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 2,3,4-trichlorobenzoic acid |
| InChIKey | ALLSOOQIDPLIER-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)Cl)Cl |
Computed by PubChem (NCBI)