cas: 1820739-95-4 — see every product listed under this CAS number, including other names
2,4,6-TRIFLUOROBENZYL METHACRYLATE, 97% (CAS 1820739-95-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F472256-100MG |
| cas | 1820739-95-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 841.39 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2,4,6-trifluorophenyl)methyl 2-methylprop-2-enoate (CAS 1820739-95-4) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: (2,4,6-trifluorophenyl)methyl 2-methylprop-2-enoate. InChIKey: KSOWESAUICTCKW-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | (2,4,6-trifluorophenyl)methyl 2-methylprop-2-enoate |
| InChIKey | KSOWESAUICTCKW-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC1=C(C=C(C=C1F)F)F |
Computed by PubChem (NCBI)