Products 886498-02-8
CAS 886498-02-8 appears in our catalog under these names: 4-Methyl-3-(trifluoromethyl)cinnamic acid, 95%, 4-Methyl-3-(trifluoromethyl)cinnamic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(E)-3-[4-methyl-3-(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 886498-02-8) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: (E)-3-[4-methyl-3-(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: NYGYUKFEDBHBBB-SNAWJCMRSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | (E)-3-[4-methyl-3-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | NYGYUKFEDBHBBB-SNAWJCMRSA-N |
| SMILES | CC1=C(C=C(C=C1)/C=C/C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)