CAS 1820739-95-4 is the registry number for 2,4,6-Trifluorobenzyl methacrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,4,6-trifluorophenyl)methyl 2-methylprop-2-enoate (CAS 1820739-95-4) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: (2,4,6-trifluorophenyl)methyl 2-methylprop-2-enoate. InChIKey: KSOWESAUICTCKW-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | (2,4,6-trifluorophenyl)methyl 2-methylprop-2-enoate |
| InChIKey | KSOWESAUICTCKW-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC1=C(C=C(C=C1F)F)F |
Computed by PubChem (NCBI)