2,4,6-Trichloropyrrolo[2,1-f][1,2,4]triazine, 98%
cas: 1315593-59-9 — see every product listed under this CAS number, including other names
2,4,6-Trichloropyrrolo[2,1-f][1,2,4]triazine, 98% (CAS 1315593-59-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A623345-250mg |
| cas | 1315593-59-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1805.50 Pln | |
| Ambeed | 1g | 4397.62 Pln | |
| Chemat | 50mg | 563.60 Pln | |
| Chemat | 100mg | 914.00 Pln | |
| Chemat | 250mg | 1552.40 Pln | |
| Chemat | 1g | 4230.80 Pln | |
| BLDpharm | 50mg | 791.97 Pln | |
| BLDpharm | 100mg | 1191.83 Pln | |
| BLDpharm | 250mg | 1941.56 Pln | |
| BLDpharm | 1g | 4735.02 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2,4,6-trichloropyrrolo[2,1-f][1,2,4]triazine (CAS 1315593-59-9) is a chemical compound with the molecular formula C6H2Cl3N3 and a molecular weight of 222.5 g/mol. IUPAC name: 2,4,6-trichloropyrrolo[2,1-f][1,2,4]triazine. InChIKey: MUULEYJDBBKDBF-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3N3 |
|---|---|
| Molecular weight | 222.5 g/mol |
| IUPAC name | 2,4,6-trichloropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | MUULEYJDBBKDBF-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=NN2C=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)