Products 1627905-79-6
CAS 1627905-79-6 appears in our catalog under these names: 2,4,5-Trichloropyrrolo[2,1-f][1,2,4]triazine, 97%, 97%, 2,4,5-Trichloropyrrolo[2,1-f][1,2,4]triazine, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 500mg, 100mg, 250mg, 1g, 10g.
2,4,5-trichloropyrrolo[2,1-f][1,2,4]triazine (CAS 1627905-79-6) is a chemical compound with the molecular formula C6H2Cl3N3 and a molecular weight of 222.5 g/mol. IUPAC name: 2,4,5-trichloropyrrolo[2,1-f][1,2,4]triazine. InChIKey: WLHRHHIDKGSWKY-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3N3 |
|---|---|
| Molecular weight | 222.5 g/mol |
| IUPAC name | 2,4,5-trichloropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | WLHRHHIDKGSWKY-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1Cl)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)