CAS 2913573-79-0 is the registry number for 1,4,8-Trichloropyrrolo[1,2-d][1,2,4]triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4,8-trichloropyrrolo[1,2-d][1,2,4]triazine (CAS 2913573-79-0) is a chemical compound with the molecular formula C6H2Cl3N3 and a molecular weight of 222.5 g/mol. IUPAC name: 1,4,8-trichloropyrrolo[1,2-d][1,2,4]triazine. InChIKey: TUFOPEBGMWMKFR-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl3N3 |
|---|---|
| Molecular weight | 222.5 g/mol |
| IUPAC name | 1,4,8-trichloropyrrolo[1,2-d][1,2,4]triazine |
| InChIKey | TUFOPEBGMWMKFR-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1Cl)C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)