cas: 220239-64-5 — see every product listed under this CAS number, including other names
2,4,6-Trifluorobenzene-1-sulfonyl chloride 98% (CAS 220239-64-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A150624-1g |
| cas | 220239-64-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 10g | 604.00 Pln | |
| Ambeed | 25g | 1171.38 Pln | |
| Ambeed | 100g | 3591.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A150624 |
2,4,6-trifluorobenzenesulfonyl chloride (CAS 220239-64-5) is a chemical compound with the molecular formula C6H2ClF3O2S and a molecular weight of 230.59 g/mol. IUPAC name: 2,4,6-trifluorobenzenesulfonyl chloride. InChIKey: XINCBNCLCIQIJM-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3O2S |
|---|---|
| Molecular weight | 230.59 g/mol |
| IUPAC name | 2,4,6-trifluorobenzenesulfonyl chloride |
| InChIKey | XINCBNCLCIQIJM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)S(=O)(=O)Cl)F)F |
Computed by PubChem (NCBI)