cas: 830-79-5 — see every product listed under this CAS number, including other names
2,4,6-Trimethoxybenzaldehyde, 98%, 98% (CAS 830-79-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115WTS-1g |
| cas | 830-79-5 |
| size | 1g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 100g | 318.80 Pln | |
| Chemat | 500g | 1416.00 Pln | |
| Chemat | 1kg | 2238.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4,6-trimethoxybenzaldehyde (CAS 830-79-5) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 2,4,6-trimethoxybenzaldehyde. InChIKey: CRBZVDLXAIFERF-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2,4,6-trimethoxybenzaldehyde |
| InChIKey | CRBZVDLXAIFERF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C=O)OC |
Computed by PubChem (NCBI)